About 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one
5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one (PubChem CID 10155917) has the molecular formula C18H19ClF2N2O2
and a molecular weight of 368.81 g/mol. Its IUPAC name is 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one |
| PubChem CID | 10155917 |
| Molecular Formula | C18H19ClF2N2O2 |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(Cl)cc1CN1CCC(COc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C18H19ClF2N2O2/c19-14-7-13(18(24)22-9-14)10-23-5-3-12(4-6-23)11-25-17-8-15(20)1-2-16(17)21/h1-2,7-9,12H,3-6,10-11H2,(H,22,24) |
| InChIKey | JYSUOSXUGJLYAR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one?
The IUPAC name of 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one (CID 10155917) is 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one.
What is the SMILES notation for 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one?
The canonical SMILES for 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one is O=c1[nH]cc(Cl)cc1CN1CCC(COc2cc(F)ccc2F)CC1.
What is the InChIKey of 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one?
The InChIKey is JYSUOSXUGJLYAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClF2N2O2/c19-14-7-13(18(24)22-9-14)10-23-5-3-12(4-6-23)11-25-17-8-15(20)1-2-16(17)21/h1-2,7-9,12H,3-6,10-11H2,(H,22,24).
What are the key properties of 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one?
5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one has a molecular weight of 368.81 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[[4-[(2,5-difluorophenoxy)methyl]piperidin-1-yl]methyl]-1H-pyridin-2-one is sourced from PubChem (CID 10155917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).