C22H29ClN2O — CID 10156170
N-methyl-2-(4-phenylphenyl)-N-(1-propan-2-ylpyrrolidin-3-yl)acetamide;hydrochloride (PubChem CID 10156170) has the molecular formula C22H29ClN2O and a molecular weight of 372.94 g/mol. Its IUPAC name is N-methyl-2-(4-phenylphenyl)-N-(1-propan-2-ylpyrrolidin-3-yl)acetamide;hydrochloride.
| Compound Name | N-methyl-2-(4-phenylphenyl)-N-(1-propan-2-ylpyrrolidin-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 10156170 |
| Molecular Formula | C22H29ClN2O |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-methyl-2-(4-phenylphenyl)-N-(1-propan-2-ylpyrrolidin-3-yl)acetamide;hydrochloride |
| SMILES | CC(C)N1CCC(N(C)C(=O)Cc2ccc(-c3ccccc3)cc2)C1.Cl |
| InChI | InChI=1S/C22H28N2O.ClH/c1-17(2)24-14-13-21(16-24)23(3)22(25)15-18-9-11-20(12-10-18)19-7-5-4-6-8-19;/h4-12,17,21H,13-16H2,1-3H3;1H |
| InChIKey | DFXINTVKKHPNGX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |