C23H35NOS — CID 10156216
2-tert-butyl-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-1,3-thiazole (PubChem CID 10156216) has the molecular formula C23H35NOS and a molecular weight of 373.61 g/mol. Its IUPAC name is 2-tert-butyl-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-1,3-thiazole.
| Compound Name | 2-tert-butyl-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 10156216 |
| Molecular Formula | C23H35NOS |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-tert-butyl-4-[(1Z,5E,7E,11R)-11-methoxy-8-methyltetradeca-1,5,7,13-tetraenyl]-1,3-thiazole |
| SMILES | C=CC[C@@H](CC/C(C)=C/C=C/CC/C=C\c1csc(C(C)(C)C)n1)OC |
| InChI | InChI=1S/C23H35NOS/c1-7-13-21(25-6)17-16-19(2)14-11-9-8-10-12-15-20-18-26-22(24-20)23(3,4)5/h7,9,11-12,14-15,18,21H,1,8,10,13,16-17H2,2-6H3/b11-9+,15-12-,19-14+/t21-/m0/s1 |
| InChIKey | MLKFUZJJOBSFGQ-KOSHRXDPSA-N |
| XLogP | 7.11 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|