C17H13BrFNO3 — CID 10156478
(9R)-9-(3-bromo-4-fluorophenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione (PubChem CID 10156478) has the molecular formula C17H13BrFNO3 and a molecular weight of 378.20 g/mol. Its IUPAC name is (9R)-9-(3-bromo-4-fluorophenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione.
| Compound Name | (9R)-9-(3-bromo-4-fluorophenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione |
|---|---|
| PubChem CID | 10156478 |
| Molecular Formula | C17H13BrFNO3 |
| Molecular Weight | 378.20 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | (9R)-9-(3-bromo-4-fluorophenyl)-3,4,5,6,7,9-hexahydrofuro[3,4-b]quinoline-1,8-dione |
| SMILES | O=C1CCCC2=C1[C@@H](c1ccc(F)c(Br)c1)C1=C(COC1=O)N2 |
| InChI | InChI=1S/C17H13BrFNO3/c18-9-6-8(4-5-10(9)19)14-15-11(2-1-3-13(15)21)20-12-7-23-17(22)16(12)14/h4-6,14,20H,1-3,7H2/t14-/m1/s1 |
| InChIKey | VSNYATFTQYFMOY-CQSZACIVSA-N |
| XLogP | 3.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |