C20H21N3O3S — CID 10156805
cyclohexyl 2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-5-yl)-2-phenylacetate (PubChem CID 10156805) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is cyclohexyl 2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-5-yl)-2-phenylacetate.
| Compound Name | cyclohexyl 2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-5-yl)-2-phenylacetate |
|---|---|
| PubChem CID | 10156805 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | cyclohexyl 2-(3-oxo-4-sulfanylidene-1,2-dihydropyrazolo[4,3-c]pyridin-5-yl)-2-phenylacetate |
| SMILES | O=C(OC1CCCCC1)C(c1ccccc1)n1ccc2[nH][nH]c(=O)c2c1=S |
| InChI | InChI=1S/C20H21N3O3S/c24-18-16-15(21-22-18)11-12-23(19(16)27)17(13-7-3-1-4-8-13)20(25)26-14-9-5-2-6-10-14/h1,3-4,7-8,11-12,14,17H,2,5-6,9-10H2,(H2,21,22,24) |
| InChIKey | AZAHXGFRMOWATQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|