About benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate
benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate (PubChem CID 10157062) has the molecular formula C18H17ClF3NO3
and a molecular weight of 387.79 g/mol. Its IUPAC name is benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate |
| PubChem CID | 10157062 |
| Molecular Formula | C18H17ClF3NO3 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate |
| SMILES | O=C(NC(Cc1ccccc1Cl)C(O)C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C18H17ClF3NO3/c19-14-9-5-4-8-13(14)10-15(16(24)18(20,21)22)23-17(25)26-11-12-6-2-1-3-7-12/h1-9,15-16,24H,10-11H2,(H,23,25) |
| InChIKey | QMFXPHKFKDZDJX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate?
The IUPAC name of benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate (CID 10157062) is benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate.
What is the SMILES notation for benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate?
The canonical SMILES for benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate is O=C(NC(Cc1ccccc1Cl)C(O)C(F)(F)F)OCc1ccccc1.
What is the InChIKey of benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate?
The InChIKey is QMFXPHKFKDZDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClF3NO3/c19-14-9-5-4-8-13(14)10-15(16(24)18(20,21)22)23-17(25)26-11-12-6-2-1-3-7-12/h1-9,15-16,24H,10-11H2,(H,23,25).
What are the key properties of benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate?
benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate has a molecular weight of 387.79 g/mol, XLogP of 4.10, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[1-(2-chlorophenyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]carbamate is sourced from PubChem (CID 10157062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).