C25H29NO3 — CID 10157287
9-ethoxy-10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 10157287) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 9-ethoxy-10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | 9-ethoxy-10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 10157287 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 9-ethoxy-10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | C=CCC1Oc2ccc(OCC)c(OC)c2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C25H29NO3/c1-7-9-18-22-16(10-11-17-21(22)15(3)14-25(4,5)26-17)23-19(29-18)12-13-20(28-8-2)24(23)27-6/h7,10-14,18,26H,1,8-9H2,2-6H3 |
| InChIKey | NYVPFFGPGWDQNH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|