C14H11F6N3O2S — CID 10157738
N-ethyl-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 10157738) has the molecular formula C14H11F6N3O2S and a molecular weight of 399.32 g/mol. Its IUPAC name is N-ethyl-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-ethyl-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 10157738 |
| Molecular Formula | C14H11F6N3O2S |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-ethyl-N-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCN(C(=O)c1ccccc1)c1nnc(C(O)(C(F)(F)F)C(F)(F)F)s1 |
| InChI | InChI=1S/C14H11F6N3O2S/c1-2-23(9(24)8-6-4-3-5-7-8)11-22-21-10(26-11)12(25,13(15,16)17)14(18,19)20/h3-7,25H,2H2,1H3 |
| InChIKey | GTSTZEJLMBTCFV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |