About N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide
N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide (PubChem CID 10157922) has the molecular formula C21H21Cl2N3O
and a molecular weight of 402.33 g/mol. Its IUPAC name is N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide |
| PubChem CID | 10157922 |
| Molecular Formula | C21H21Cl2N3O |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide |
| SMILES | Cn1c(C(=O)NC(C)(C)C)nc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O/c1-21(2,3)25-20(27)19-24-17(13-5-9-15(22)10-6-13)18(26(19)4)14-7-11-16(23)12-8-14/h5-12H,1-4H3,(H,25,27) |
| InChIKey | KSOFDKXGGLAUJF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide?
The IUPAC name of N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide (CID 10157922) is N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide.
What is the SMILES notation for N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide?
The canonical SMILES for N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide is Cn1c(C(=O)NC(C)(C)C)nc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1.
What is the InChIKey of N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide?
The InChIKey is KSOFDKXGGLAUJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Cl2N3O/c1-21(2,3)25-20(27)19-24-17(13-5-9-15(22)10-6-13)18(26(19)4)14-7-11-16(23)12-8-14/h5-12H,1-4H3,(H,25,27).
What are the key properties of N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide?
N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide has a molecular weight of 402.33 g/mol, XLogP of 5.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4,5-bis(4-chlorophenyl)-1-methylimidazole-2-carboxamide is sourced from PubChem (CID 10157922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).