C21H26F2N4O2 — CID 10158094
(3S)-5,5-difluoro-3-pyrimidin-5-yl-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 10158094) has the molecular formula C21H26F2N4O2 and a molecular weight of 404.46 g/mol. Its IUPAC name is (3S)-5,5-difluoro-3-pyrimidin-5-yl-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | (3S)-5,5-difluoro-3-pyrimidin-5-yl-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 10158094 |
| Molecular Formula | C21H26F2N4O2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (3S)-5,5-difluoro-3-pyrimidin-5-yl-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | O=C(O)C[C@@H](CC(F)(F)CCCCc1ccc2c(n1)NCCC2)c1cncnc1 |
| InChI | InChI=1S/C21H26F2N4O2/c22-21(23,11-16(10-19(28)29)17-12-24-14-25-13-17)8-2-1-5-18-7-6-15-4-3-9-26-20(15)27-18/h6-7,12-14,16H,1-5,8-11H2,(H,26,27)(H,28,29)/t16-/m0/s1 |
| InChIKey | BBEAIKPYKJVQJF-INIZCTEOSA-N |
| XLogP | 4.23 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|