About N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine
N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine (PubChem CID 10158145) has the molecular formula C22H14F3N5
and a molecular weight of 405.38 g/mol. Its IUPAC name is N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine.
Molecular Properties
| Compound Name | N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine |
| PubChem CID | 10158145 |
| Molecular Formula | C22H14F3N5 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine |
| SMILES | FC(F)(F)c1ccccc1-c1cc(Nc2n[nH]c3ccccc23)c2cccnc2n1 |
| InChI | InChI=1S/C22H14F3N5/c23-22(24,25)16-9-3-1-6-13(16)18-12-19(15-8-5-11-26-20(15)27-18)28-21-14-7-2-4-10-17(14)29-30-21/h1-12H,(H2,26,27,28,29,30) |
| InChIKey | NFTSSGQFXRSWKP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine?
The IUPAC name of N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine (CID 10158145) is N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine.
What is the SMILES notation for N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine?
The canonical SMILES for N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine is FC(F)(F)c1ccccc1-c1cc(Nc2n[nH]c3ccccc23)c2cccnc2n1.
What is the InChIKey of N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine?
The InChIKey is NFTSSGQFXRSWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14F3N5/c23-22(24,25)16-9-3-1-6-13(16)18-12-19(15-8-5-11-26-20(15)27-18)28-21-14-7-2-4-10-17(14)29-30-21/h1-12H,(H2,26,27,28,29,30).
What are the key properties of N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine?
N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine has a molecular weight of 405.38 g/mol, XLogP of 5.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indazol-3-yl)-2-[2-(trifluoromethyl)phenyl]-1,8-naphthyridin-4-amine is sourced from PubChem (CID 10158145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).