About 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one
2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one (PubChem CID 10158306) has the molecular formula C23H25N3O4
and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one.
Molecular Properties
| Compound Name | 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one |
| PubChem CID | 10158306 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one |
| SMILES | COc1ccc2c(=O)cc(-c3ccc4nc(CCCN(C)C)[nH]c4c3)oc2c1OC |
| InChI | InChI=1S/C23H25N3O4/c1-26(2)11-5-6-21-24-16-9-7-14(12-17(16)25-21)20-13-18(27)15-8-10-19(28-3)23(29-4)22(15)30-20/h7-10,12-13H,5-6,11H2,1-4H3,(H,24,25) |
| InChIKey | SBKAZLULBNKBCO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one?
The IUPAC name of 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one (CID 10158306) is 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one.
What is the SMILES notation for 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one?
The canonical SMILES for 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one is COc1ccc2c(=O)cc(-c3ccc4nc(CCCN(C)C)[nH]c4c3)oc2c1OC.
What is the InChIKey of 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one?
The InChIKey is SBKAZLULBNKBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O4/c1-26(2)11-5-6-21-24-16-9-7-14(12-17(16)25-21)20-13-18(27)15-8-10-19(28-3)23(29-4)22(15)30-20/h7-10,12-13H,5-6,11H2,1-4H3,(H,24,25).
What are the key properties of 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one?
2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one has a molecular weight of 407.47 g/mol, XLogP of 3.85, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[3-(dimethylamino)propyl]-3H-benzimidazol-5-yl]-7,8-dimethoxychromen-4-one is sourced from PubChem (CID 10158306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).