C25H30FN3O — CID 10158326
5-fluoro-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]cyclohexyl]-1H-indole (PubChem CID 10158326) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is 5-fluoro-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]cyclohexyl]-1H-indole.
| Compound Name | 5-fluoro-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]cyclohexyl]-1H-indole |
|---|---|
| PubChem CID | 10158326 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 5-fluoro-3-[4-[4-(2-methoxyphenyl)piperazin-1-yl]cyclohexyl]-1H-indole |
| SMILES | COc1ccccc1N1CCN(C2CCC(c3c[nH]c4ccc(F)cc34)CC2)CC1 |
| InChI | InChI=1S/C25H30FN3O/c1-30-25-5-3-2-4-24(25)29-14-12-28(13-15-29)20-9-6-18(7-10-20)22-17-27-23-11-8-19(26)16-21(22)23/h2-5,8,11,16-18,20,27H,6-7,9-10,12-15H2,1H3 |
| InChIKey | PXPDZPCPTSKVAX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |