C23H26ClN5 — CID 10158338
13-chloro-2-[4-[(1-methylimidazol-4-yl)methyl]piperazin-1-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 10158338) has the molecular formula C23H26ClN5 and a molecular weight of 407.95 g/mol. Its IUPAC name is 13-chloro-2-[4-[(1-methylimidazol-4-yl)methyl]piperazin-1-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 13-chloro-2-[4-[(1-methylimidazol-4-yl)methyl]piperazin-1-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 10158338 |
| Molecular Formula | C23H26ClN5 |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 13-chloro-2-[4-[(1-methylimidazol-4-yl)methyl]piperazin-1-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | Cn1cnc(CN2CCN(C3c4ccc(Cl)cc4CCc4cccnc43)CC2)c1 |
| InChI | InChI=1S/C23H26ClN5/c1-27-14-20(26-16-27)15-28-9-11-29(12-10-28)23-21-7-6-19(24)13-18(21)5-4-17-3-2-8-25-22(17)23/h2-3,6-8,13-14,16,23H,4-5,9-12,15H2,1H3 |
| InChIKey | ANSOXMTVHCJKLF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |