C17H16F6N2O3 — CID 10158463
N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]-2-methylpropanamide (PubChem CID 10158463) has the molecular formula C17H16F6N2O3 and a molecular weight of 410.31 g/mol. Its IUPAC name is N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]-2-methylpropanamide.
| Compound Name | N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 10158463 |
| Molecular Formula | C17H16F6N2O3 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]-2-methylpropanamide |
| SMILES | Cc1onc(NC(=O)C(C)C)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F6N2O3/c1-8(2)14(26)24-13-12(9(3)28-25-13)10-4-6-11(7-5-10)15(27,16(18,19)20)17(21,22)23/h4-8,27H,1-3H3,(H,24,25,26) |
| InChIKey | PLKOFLIKTZZABW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |