C27H34N2O2 — CID 10159012
5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 10159012) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10159012 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 5-[[4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propan-2-yl]phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(C)(C)c3ccc(CC4NC(=O)NC4=O)cc3)ccc21 |
| InChI | InChI=1S/C27H34N2O2/c1-25(2)13-14-26(3,4)21-16-19(11-12-20(21)25)27(5,6)18-9-7-17(8-10-18)15-22-23(30)29-24(31)28-22/h7-12,16,22H,13-15H2,1-6H3,(H2,28,29,30,31) |
| InChIKey | QQJXNXOVRLERIP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|