C23H19ClN4O2 — CID 10159021
N-(2-aminophenyl)-4-[(6-chloro-2-methyl-4-oxoquinazolin-3-yl)methyl]benzamide (PubChem CID 10159021) has the molecular formula C23H19ClN4O2 and a molecular weight of 418.88 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(6-chloro-2-methyl-4-oxoquinazolin-3-yl)methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(6-chloro-2-methyl-4-oxoquinazolin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 10159021 |
| Molecular Formula | C23H19ClN4O2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-(2-aminophenyl)-4-[(6-chloro-2-methyl-4-oxoquinazolin-3-yl)methyl]benzamide |
| SMILES | Cc1nc2ccc(Cl)cc2c(=O)n1Cc1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C23H19ClN4O2/c1-14-26-20-11-10-17(24)12-18(20)23(30)28(14)13-15-6-8-16(9-7-15)22(29)27-21-5-3-2-4-19(21)25/h2-12H,13,25H2,1H3,(H,27,29) |
| InChIKey | MOSZOVPEOFCBJI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|