About 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole
2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole (PubChem CID 10159042) has the molecular formula C19H15F2N3O2S2
and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole |
| PubChem CID | 10159042 |
| Molecular Formula | C19H15F2N3O2S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole |
| SMILES | Cc1cccc2sc(-n3nc(C(F)F)cc3-c3ccc(S(C)(=O)=O)cc3)nc12 |
| InChI | InChI=1S/C19H15F2N3O2S2/c1-11-4-3-5-16-17(11)22-19(27-16)24-15(10-14(23-24)18(20)21)12-6-8-13(9-7-12)28(2,25)26/h3-10,18H,1-2H3 |
| InChIKey | WKMFTBMAOMVOHP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole?
The IUPAC name of 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole (CID 10159042) is 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole.
What is the SMILES notation for 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole?
The canonical SMILES for 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole is Cc1cccc2sc(-n3nc(C(F)F)cc3-c3ccc(S(C)(=O)=O)cc3)nc12.
What is the InChIKey of 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole?
The InChIKey is WKMFTBMAOMVOHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2N3O2S2/c1-11-4-3-5-16-17(11)22-19(27-16)24-15(10-14(23-24)18(20)21)12-6-8-13(9-7-12)28(2,25)26/h3-10,18H,1-2H3.
What are the key properties of 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole?
2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole has a molecular weight of 419.48 g/mol, XLogP of 4.80, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(difluoromethyl)-5-(4-methylsulfonylphenyl)pyrazol-1-yl]-4-methyl-1,3-benzothiazole is sourced from PubChem (CID 10159042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).