C25H28N2O4 — CID 10159118
(4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 10159118) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10159118 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1cc(C)c(C2=NO[C@H](C(=O)N3C(=O)OC(C)(C)[C@@H]3Cc3ccccc3)C2)c(C)c1 |
| InChI | InChI=1S/C25H28N2O4/c1-15-11-16(2)22(17(3)12-15)19-14-20(31-26-19)23(28)27-21(25(4,5)30-24(27)29)13-18-9-7-6-8-10-18/h6-12,20-21H,13-14H2,1-5H3/t20-,21-/m0/s1 |
| InChIKey | YDNSECIJQBPFEO-SFTDATJTSA-N |
| XLogP | 4.47 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |