About 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one
1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one (PubChem CID 10159139) has the molecular formula C26H32N2O3
and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one |
| PubChem CID | 10159139 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one |
| SMILES | COc1cc2c(-c3ccc(C(C)C)cc3)nc(=O)n(CC3CCCCC3)c2cc1OC |
| InChI | InChI=1S/C26H32N2O3/c1-17(2)19-10-12-20(13-11-19)25-21-14-23(30-3)24(31-4)15-22(21)28(26(29)27-25)16-18-8-6-5-7-9-18/h10-15,17-18H,5-9,16H2,1-4H3 |
| InChIKey | OZQLEAQCIQBJDA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one?
The IUPAC name of 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one (CID 10159139) is 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one.
What is the SMILES notation for 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one?
The canonical SMILES for 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one is COc1cc2c(-c3ccc(C(C)C)cc3)nc(=O)n(CC3CCCCC3)c2cc1OC.
What is the InChIKey of 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one?
The InChIKey is OZQLEAQCIQBJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N2O3/c1-17(2)19-10-12-20(13-11-19)25-21-14-23(30-3)24(31-4)15-22(21)28(26(29)27-25)16-18-8-6-5-7-9-18/h10-15,17-18H,5-9,16H2,1-4H3.
What are the key properties of 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one?
1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one has a molecular weight of 420.55 g/mol, XLogP of 5.78, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)-6,7-dimethoxy-4-(4-propan-2-ylphenyl)quinazolin-2-one is sourced from PubChem (CID 10159139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).