About N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide
N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide (PubChem CID 10159196) has the molecular formula C25H31N3O3
and a molecular weight of 421.54 g/mol. Its IUPAC name is N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide.
Molecular Properties
| Compound Name | N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide |
| PubChem CID | 10159196 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide |
| SMILES | NCCCCCN(Cc1ccc2c(c1)OCO2)C(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H31N3O3/c26-13-4-1-5-14-28(17-19-11-12-23-24(15-19)31-18-30-23)25(29)10-6-7-20-16-27-22-9-3-2-8-21(20)22/h2-3,8-9,11-12,15-16,27H,1,4-7,10,13-14,17-18,26H2 |
| InChIKey | KCBYGHZJZXZHQZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide?
The IUPAC name of N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide (CID 10159196) is N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide.
What is the SMILES notation for N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide?
The canonical SMILES for N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide is NCCCCCN(Cc1ccc2c(c1)OCO2)C(=O)CCCc1c[nH]c2ccccc12.
What is the InChIKey of N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide?
The InChIKey is KCBYGHZJZXZHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31N3O3/c26-13-4-1-5-14-28(17-19-11-12-23-24(15-19)31-18-30-23)25(29)10-6-7-20-16-27-22-9-3-2-8-21(20)22/h2-3,8-9,11-12,15-16,27H,1,4-7,10,13-14,17-18,26H2.
What are the key properties of N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide?
N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide has a molecular weight of 421.54 g/mol, XLogP of 4.38, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-aminopentyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide is sourced from PubChem (CID 10159196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).