About 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one
3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 10159203) has the molecular formula C26H35N3O2
and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| PubChem CID | 10159203 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | Cc1ccc(C)c(OC(CCN2CCC(n3c(=O)[nH]c4ccccc43)CC2)C(C)C)c1 |
| InChI | InChI=1S/C26H35N3O2/c1-18(2)24(31-25-17-19(3)9-10-20(25)4)13-16-28-14-11-21(12-15-28)29-23-8-6-5-7-22(23)27-26(29)30/h5-10,17-18,21,24H,11-16H2,1-4H3,(H,27,30) |
| InChIKey | JRSDTDHTWWDFQP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one?
The IUPAC name of 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one (CID 10159203) is 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one.
What is the SMILES notation for 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one?
The canonical SMILES for 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one is Cc1ccc(C)c(OC(CCN2CCC(n3c(=O)[nH]c4ccccc43)CC2)C(C)C)c1.
What is the InChIKey of 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one?
The InChIKey is JRSDTDHTWWDFQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35N3O2/c1-18(2)24(31-25-17-19(3)9-10-20(25)4)13-16-28-14-11-21(12-15-28)29-23-8-6-5-7-22(23)27-26(29)30/h5-10,17-18,21,24H,11-16H2,1-4H3,(H,27,30).
What are the key properties of 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one?
3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one has a molecular weight of 421.59 g/mol, XLogP of 5.08, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[3-(2,5-dimethylphenoxy)-4-methylpentyl]piperidin-4-yl]-1H-benzimidazol-2-one is sourced from PubChem (CID 10159203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).