C26H40O5 — CID 10159944
6-[5-[2-[5-(6-hydroxy-5,5-dimethylhexyl)furan-2-yl]ethyl]furan-2-yl]-2,2-dimethylhexanoic acid (PubChem CID 10159944) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is 6-[5-[2-[5-(6-hydroxy-5,5-dimethylhexyl)furan-2-yl]ethyl]furan-2-yl]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[5-[2-[5-(6-hydroxy-5,5-dimethylhexyl)furan-2-yl]ethyl]furan-2-yl]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 10159944 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 6-[5-[2-[5-(6-hydroxy-5,5-dimethylhexyl)furan-2-yl]ethyl]furan-2-yl]-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CO)CCCCc1ccc(CCc2ccc(CCCCC(C)(C)C(=O)O)o2)o1 |
| InChI | InChI=1S/C26H40O5/c1-25(2,19-27)17-7-5-9-20-11-13-22(30-20)15-16-23-14-12-21(31-23)10-6-8-18-26(3,4)24(28)29/h11-14,27H,5-10,15-19H2,1-4H3,(H,28,29) |
| InChIKey | QMZADVAINQJIQQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|