C20H18F3N5OS — CID 10159965
[4-amino-2-(4-piperazin-1-ylanilino)-1,3-thiazol-5-yl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 10159965) has the molecular formula C20H18F3N5OS and a molecular weight of 433.46 g/mol. Its IUPAC name is [4-amino-2-(4-piperazin-1-ylanilino)-1,3-thiazol-5-yl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [4-amino-2-(4-piperazin-1-ylanilino)-1,3-thiazol-5-yl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 10159965 |
| Molecular Formula | C20H18F3N5OS |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [4-amino-2-(4-piperazin-1-ylanilino)-1,3-thiazol-5-yl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | Nc1nc(Nc2ccc(N3CCNCC3)cc2)sc1C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C20H18F3N5OS/c21-14-9-11(10-15(22)16(14)23)17(29)18-19(24)27-20(30-18)26-12-1-3-13(4-2-12)28-7-5-25-6-8-28/h1-4,9-10,25H,5-8,24H2,(H,26,27) |
| InChIKey | LWIBIVLBWSRWJC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|