C26H30N2O4 — CID 10160073
ethyl 6-butyl-17-methoxy-12-oxa-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14(19),15,17-heptaene-5-carboxylate (PubChem CID 10160073) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is ethyl 6-butyl-17-methoxy-12-oxa-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14(19),15,17-heptaene-5-carboxylate.
| Compound Name | ethyl 6-butyl-17-methoxy-12-oxa-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14(19),15,17-heptaene-5-carboxylate |
|---|---|
| PubChem CID | 10160073 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | ethyl 6-butyl-17-methoxy-12-oxa-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14(19),15,17-heptaene-5-carboxylate |
| SMILES | CCCCc1[nH]c2ccc3c(c2c1C(=O)OCC)CN1CCc2cc(OC)ccc2C1O3 |
| InChI | InChI=1S/C26H30N2O4/c1-4-6-7-20-24(26(29)31-5-2)23-19-15-28-13-12-16-14-17(30-3)8-9-18(16)25(28)32-22(19)11-10-21(23)27-20/h8-11,14,25,27H,4-7,12-13,15H2,1-3H3 |
| InChIKey | XQLXDIIVOCDWBZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |