C27H20N2O4 — CID 10160182
methyl 2-[[2-(1-benzofuran-2-yl)quinoline-4-carbonyl]amino]-2-phenylacetate (PubChem CID 10160182) has the molecular formula C27H20N2O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is methyl 2-[[2-(1-benzofuran-2-yl)quinoline-4-carbonyl]amino]-2-phenylacetate.
| Compound Name | methyl 2-[[2-(1-benzofuran-2-yl)quinoline-4-carbonyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 10160182 |
| Molecular Formula | C27H20N2O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | methyl 2-[[2-(1-benzofuran-2-yl)quinoline-4-carbonyl]amino]-2-phenylacetate |
| SMILES | COC(=O)C(NC(=O)c1cc(-c2cc3ccccc3o2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C27H20N2O4/c1-32-27(31)25(17-9-3-2-4-10-17)29-26(30)20-16-22(28-21-13-7-6-12-19(20)21)24-15-18-11-5-8-14-23(18)33-24/h2-16,25H,1H3,(H,29,30) |
| InChIKey | ZLODJFMIOPIMTQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |