C18H18INO4 — CID 10160366
4-(3,4-dimethoxyphenyl)-8-iodo-1,2,3,4-tetrahydroquinoline-2-carboxylic acid (PubChem CID 10160366) has the molecular formula C18H18INO4 and a molecular weight of 439.25 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-8-iodo-1,2,3,4-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | 4-(3,4-dimethoxyphenyl)-8-iodo-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 10160366 |
| Molecular Formula | C18H18INO4 |
| Molecular Weight | 439.25 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-8-iodo-1,2,3,4-tetrahydroquinoline-2-carboxylic acid |
| SMILES | COc1ccc(C2CC(C(=O)O)Nc3c(I)cccc32)cc1OC |
| InChI | InChI=1S/C18H18INO4/c1-23-15-7-6-10(8-16(15)24-2)12-9-14(18(21)22)20-17-11(12)4-3-5-13(17)19/h3-8,12,14,20H,9H2,1-2H3,(H,21,22) |
| InChIKey | DRPXZLDRNRBKJO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|