C27H26N2O4 — CID 10160567
1-cyclopentyl-2-[4-[(4-methoxyphenyl)methoxy]phenyl]benzimidazole-5-carboxylic acid (PubChem CID 10160567) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-cyclopentyl-2-[4-[(4-methoxyphenyl)methoxy]phenyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclopentyl-2-[4-[(4-methoxyphenyl)methoxy]phenyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 10160567 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-cyclopentyl-2-[4-[(4-methoxyphenyl)methoxy]phenyl]benzimidazole-5-carboxylic acid |
| SMILES | COc1ccc(COc2ccc(-c3nc4cc(C(=O)O)ccc4n3C3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O4/c1-32-22-11-6-18(7-12-22)17-33-23-13-8-19(9-14-23)26-28-24-16-20(27(30)31)10-15-25(24)29(26)21-4-2-3-5-21/h6-16,21H,2-5,17H2,1H3,(H,30,31) |
| InChIKey | ZQWPOOPPWFNRCA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |