C19H23F6NO4 — CID 10160614
methyl 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(2-methylpropanoyl)anilino]pentanoate (PubChem CID 10160614) has the molecular formula C19H23F6NO4 and a molecular weight of 443.38 g/mol. Its IUPAC name is methyl 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(2-methylpropanoyl)anilino]pentanoate.
| Compound Name | methyl 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(2-methylpropanoyl)anilino]pentanoate |
|---|---|
| PubChem CID | 10160614 |
| Molecular Formula | C19H23F6NO4 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | methyl 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(2-methylpropanoyl)anilino]pentanoate |
| SMILES | COC(=O)CCCCN(C(=O)C(C)C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H23F6NO4/c1-12(2)16(28)26(11-5-4-6-15(27)30-3)14-9-7-13(8-10-14)17(29,18(20,21)22)19(23,24)25/h7-10,12,29H,4-6,11H2,1-3H3 |
| InChIKey | KOMQBSDRYCOQSM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|