C24H23N5O2S — CID 10160792
1-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone (PubChem CID 10160792) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is 1-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone.
| Compound Name | 1-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 10160792 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1-(4-hydroxy-4-pyridin-2-ylpiperidin-1-yl)-2-phenyl-2-(4-sulfanylidene-1H-pyrazolo[4,5-c]pyridin-5-yl)ethanone |
| SMILES | O=C(C(c1ccccc1)n1ccc2[nH]ncc2c1=S)N1CCC(O)(c2ccccn2)CC1 |
| InChI | InChI=1S/C24H23N5O2S/c30-22(28-14-10-24(31,11-15-28)20-8-4-5-12-25-20)21(17-6-2-1-3-7-17)29-13-9-19-18(23(29)32)16-26-27-19/h1-9,12-13,16,21,31H,10-11,14-15H2,(H,26,27) |
| InChIKey | RCIRLWFFRCOHGA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|