C26H34N4O3 — CID 10161106
(2R)-N-[(1S)-1-(1H-benzo[f]benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide (PubChem CID 10161106) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is (2R)-N-[(1S)-1-(1H-benzo[f]benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide.
| Compound Name | (2R)-N-[(1S)-1-(1H-benzo[f]benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
|---|---|
| PubChem CID | 10161106 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (2R)-N-[(1S)-1-(1H-benzo[f]benzimidazol-2-yl)-2,2-dimethylpropyl]-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanamide |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CC1CCCC1)CN(O)C=O)c1nc2cc3ccccc3cc2[nH]1 |
| InChI | InChI=1S/C26H34N4O3/c1-26(2,3)23(24-27-21-13-18-10-6-7-11-19(18)14-22(21)28-24)29-25(32)20(15-30(33)16-31)12-17-8-4-5-9-17/h6-7,10-11,13-14,16-17,20,23,33H,4-5,8-9,12,15H2,1-3H3,(H,27,28)(H,29,32)/t20-,23-/m1/s1 |
| InChIKey | BFJJBUMUYSPIAW-NFBKMPQASA-N |
| XLogP | 4.96 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|