C44H44F2O4 — CID 101611794
[(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] (E)-8-[bis(4-fluorophenyl)methylidene]-9-methyl-3,5-dioxodec-6-enoate (PubChem CID 101611794) has the molecular formula C44H44F2O4 and a molecular weight of 674.80 g/mol. Its IUPAC name is [(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] (E)-8-[bis(4-fluorophenyl)methylidene]-9-methyl-3,5-dioxodec-6-enoate.
| Compound Name | [(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] (E)-8-[bis(4-fluorophenyl)methylidene]-9-methyl-3,5-dioxodec-6-enoate |
|---|---|
| PubChem CID | 101611794 |
| Molecular Formula | C44H44F2O4 |
| Molecular Weight | 674.80 g/mol |
| Exact Mass | 674.32 |
| IUPAC Name | [(1S,2R,3R,4S)-4,7,7-trimethyl-3-naphthalen-1-yl-2-bicyclo[2.2.1]heptanyl] (E)-8-[bis(4-fluorophenyl)methylidene]-9-methyl-3,5-dioxodec-6-enoate |
| SMILES | CC(C)C(=C(C1=CC=C(C=C1)F)C2=CC=C(C=C2)F)/C=C/C(=O)CC(=O)CC(=O)O[C@@H]3[C@H]4CC[C@@]([C@@H]3C5=CC=CC6=CC=CC=C65)(C4(C)C)C |
| InChI | InChI=1S/C44H44F2O4/c1-27(2)35(40(29-13-17-31(45)18-14-29)30-15-19-32(46)20-16-30)22-21-33(47)25-34(48)26-39(49)50-42-38-23-24-44(5,43(38,3)4)41(42)37-12-8-10-28-9-6-7-11-36(28)37/h6-22,27,38,41-42H,23-26H2,1-5H3/b22-21+/t38-,41-,42-,44+/m1/s1 |
| InChIKey | UOBGMHSGVCTHBX-ISAOKRNYSA-N |
| XLogP | 11.60 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | 1270 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.80 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|