About methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate
methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate (PubChem CID 10161259) has the molecular formula C22H17F2N5O4
and a molecular weight of 453.41 g/mol. Its IUPAC name is methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate |
| PubChem CID | 10161259 |
| Molecular Formula | C22H17F2N5O4 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2ccc(Oc3ccc(NC(=O)Nc4cc(F)ccc4F)cc3)cc2[nH]1 |
| InChI | InChI=1S/C22H17F2N5O4/c1-32-22(31)29-20-26-17-9-7-15(11-19(17)27-20)33-14-5-3-13(4-6-14)25-21(30)28-18-10-12(23)2-8-16(18)24/h2-11H,1H3,(H2,25,28,30)(H2,26,27,29,31) |
| InChIKey | KRAIQVKNMMQTGK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 117.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate?
The IUPAC name of methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate (CID 10161259) is methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate.
What is the SMILES notation for methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate?
The canonical SMILES for methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate is COC(=O)Nc1nc2ccc(Oc3ccc(NC(=O)Nc4cc(F)ccc4F)cc3)cc2[nH]1.
What is the InChIKey of methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate?
The InChIKey is KRAIQVKNMMQTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F2N5O4/c1-32-22(31)29-20-26-17-9-7-15(11-19(17)27-20)33-14-5-3-13(4-6-14)25-21(30)28-18-10-12(23)2-8-16(18)24/h2-11H,1H3,(H2,25,28,30)(H2,26,27,29,31).
What are the key properties of methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate?
methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate has a molecular weight of 453.41 g/mol, XLogP of 5.46, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[6-[4-[(2,5-difluorophenyl)carbamoylamino]phenoxy]-1H-benzimidazol-2-yl]carbamate is sourced from PubChem (CID 10161259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).