About 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid
6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid (PubChem CID 10161315) has the molecular formula C27H22N2O5
and a molecular weight of 454.48 g/mol. Its IUPAC name is 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid |
| PubChem CID | 10161315 |
| Molecular Formula | C27H22N2O5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)nc1 |
| InChI | InChI=1S/C27H22N2O5/c30-26(29-25-12-11-21(16-28-25)27(31)32)22-13-23(33-17-19-7-3-1-4-8-19)15-24(14-22)34-18-20-9-5-2-6-10-20/h1-16H,17-18H2,(H,31,32)(H,28,29,30) |
| InChIKey | GDIONXWSZRJUGV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid?
The IUPAC name of 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid (CID 10161315) is 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid is O=C(O)c1ccc(NC(=O)c2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)nc1.
What is the InChIKey of 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid?
The InChIKey is GDIONXWSZRJUGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22N2O5/c30-26(29-25-12-11-21(16-28-25)27(31)32)22-13-23(33-17-19-7-3-1-4-8-19)15-24(14-22)34-18-20-9-5-2-6-10-20/h1-16H,17-18H2,(H,31,32)(H,28,29,30).
What are the key properties of 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid?
6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid has a molecular weight of 454.48 g/mol, XLogP of 5.19, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[3,5-bis(phenylmethoxy)benzoyl]amino]pyridine-3-carboxylic acid is sourced from PubChem (CID 10161315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).