C24H30N4O3S — CID 10161344
N-cyclohexyl-1-(4-hydroxybutyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide (PubChem CID 10161344) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is N-cyclohexyl-1-(4-hydroxybutyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide.
| Compound Name | N-cyclohexyl-1-(4-hydroxybutyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 10161344 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-cyclohexyl-1-(4-hydroxybutyl)-N-methyl-2-(thiophene-2-carbonylamino)benzimidazole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)nc(NC(=O)c1cccs1)n2CCCCO)C1CCCCC1 |
| InChI | InChI=1S/C24H30N4O3S/c1-27(18-8-3-2-4-9-18)23(31)17-11-12-20-19(16-17)25-24(28(20)13-5-6-14-29)26-22(30)21-10-7-15-32-21/h7,10-12,15-16,18,29H,2-6,8-9,13-14H2,1H3,(H,25,26,30) |
| InChIKey | DDHAYBDYGVBDMH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|