C19H16Cl2N2O3S2 — CID 10161374
2,4-dichloro-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)-6-methylbenzenesulfonamide (PubChem CID 10161374) has the molecular formula C19H16Cl2N2O3S2 and a molecular weight of 455.39 g/mol. Its IUPAC name is 2,4-dichloro-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)-6-methylbenzenesulfonamide.
| Compound Name | 2,4-dichloro-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)-6-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10161374 |
| Molecular Formula | C19H16Cl2N2O3S2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | 2,4-dichloro-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)-6-methylbenzenesulfonamide |
| SMILES | COc1ccc2c(c1)CCc1sc(NS(=O)(=O)c3c(C)cc(Cl)cc3Cl)nc1-2 |
| InChI | InChI=1S/C19H16Cl2N2O3S2/c1-10-7-12(20)9-15(21)18(10)28(24,25)23-19-22-17-14-5-4-13(26-2)8-11(14)3-6-16(17)27-19/h4-5,7-9H,3,6H2,1-2H3,(H,22,23) |
| InChIKey | JJWMKRNBYQJEHX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|