C20H26F6N2O3 — CID 10161428
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-hexylmorpholine-4-carboxamide (PubChem CID 10161428) has the molecular formula C20H26F6N2O3 and a molecular weight of 456.43 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-hexylmorpholine-4-carboxamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-hexylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 10161428 |
| Molecular Formula | C20H26F6N2O3 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-hexylmorpholine-4-carboxamide |
| SMILES | CCCCCCN(C(=O)N1CCOCC1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H26F6N2O3/c1-2-3-4-5-10-28(17(29)27-11-13-31-14-12-27)16-8-6-15(7-9-16)18(30,19(21,22)23)20(24,25)26/h6-9,30H,2-5,10-14H2,1H3 |
| InChIKey | ZVJPTTYECVNKHY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|