About 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one
1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one (PubChem CID 10161539) has the molecular formula C19H19BrCl2N2O2
and a molecular weight of 458.18 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one |
| PubChem CID | 10161539 |
| Molecular Formula | C19H19BrCl2N2O2 |
| Molecular Weight | 458.18 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one |
| SMILES | O=C1N(Cc2ccc(Cl)cc2Cl)CC(CCO)CN1c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H19BrCl2N2O2/c20-15-2-5-17(6-3-15)24-11-13(7-8-25)10-23(19(24)26)12-14-1-4-16(21)9-18(14)22/h1-6,9,13,25H,7-8,10-12H2 |
| InChIKey | VQSJVCXMPCUENY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.18 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one?
The IUPAC name of 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one (CID 10161539) is 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one?
The canonical SMILES for 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one is O=C1N(Cc2ccc(Cl)cc2Cl)CC(CCO)CN1c1ccc(Br)cc1.
What is the InChIKey of 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one?
The InChIKey is VQSJVCXMPCUENY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrCl2N2O2/c20-15-2-5-17(6-3-15)24-11-13(7-8-25)10-23(19(24)26)12-14-1-4-16(21)9-18(14)22/h1-6,9,13,25H,7-8,10-12H2.
What are the key properties of 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one?
1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one has a molecular weight of 458.18 g/mol, XLogP of 5.20, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-3-[(2,4-dichlorophenyl)methyl]-5-(2-hydroxyethyl)-1,3-diazinan-2-one is sourced from PubChem (CID 10161539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).