C25H26N6O3 — CID 10161563
ethyl 9-[[4-(dimethylamino)phenyl]methyl]-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate (PubChem CID 10161563) has the molecular formula C25H26N6O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is ethyl 9-[[4-(dimethylamino)phenyl]methyl]-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate.
| Compound Name | ethyl 9-[[4-(dimethylamino)phenyl]methyl]-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate |
|---|---|
| PubChem CID | 10161563 |
| Molecular Formula | C25H26N6O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | ethyl 9-[[4-(dimethylamino)phenyl]methyl]-15-methoxy-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1Cn1c(Cc3ccc(N(C)C)cc3)nnc1-c1cc(OC)ccc1-2 |
| InChI | InChI=1S/C25H26N6O3/c1-5-34-25(32)23-21-14-30-22(12-16-6-8-17(9-7-16)29(2)3)27-28-24(30)19-13-18(33-4)10-11-20(19)31(21)15-26-23/h6-11,13,15H,5,12,14H2,1-4H3 |
| InChIKey | KYKGEOMYQXYMBC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|