C24H20F3NO5 — CID 10161610
(2,3,6-trifluorophenyl) 1,4,6-trimethoxy-10-methyl-9H-acridine-9-carboxylate (PubChem CID 10161610) has the molecular formula C24H20F3NO5 and a molecular weight of 459.42 g/mol. Its IUPAC name is (2,3,6-trifluorophenyl) 1,4,6-trimethoxy-10-methyl-9H-acridine-9-carboxylate.
| Compound Name | (2,3,6-trifluorophenyl) 1,4,6-trimethoxy-10-methyl-9H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 10161610 |
| Molecular Formula | C24H20F3NO5 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (2,3,6-trifluorophenyl) 1,4,6-trimethoxy-10-methyl-9H-acridine-9-carboxylate |
| SMILES | COc1ccc2c(c1)N(C)c1c(OC)ccc(OC)c1C2C(=O)Oc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C24H20F3NO5/c1-28-16-11-12(30-2)5-6-13(16)19(20-17(31-3)9-10-18(32-4)22(20)28)24(29)33-23-15(26)8-7-14(25)21(23)27/h5-11,19H,1-4H3 |
| InChIKey | MTKNDZVEJHRAEA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|