C29H22N2O4 — CID 10161792
[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-phenylfuran-2-yl)methanone (PubChem CID 10161792) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-phenylfuran-2-yl)methanone.
| Compound Name | [1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-phenylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 10161792 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(5-phenylfuran-2-yl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)o1)N1CCc2c([nH]c3ccccc23)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H22N2O4/c32-29(25-13-12-23(35-25)18-6-2-1-3-7-18)31-15-14-21-20-8-4-5-9-22(20)30-27(21)28(31)19-10-11-24-26(16-19)34-17-33-24/h1-13,16,28,30H,14-15,17H2 |
| InChIKey | DNNLFXSQOUYPSH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 67.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|