C22H26N2O7S — CID 10161796
[(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] N-thiophen-2-ylcarbamate (PubChem CID 10161796) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is [(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] N-thiophen-2-ylcarbamate.
| Compound Name | [(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] N-thiophen-2-ylcarbamate |
|---|---|
| PubChem CID | 10161796 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] N-thiophen-2-ylcarbamate |
| SMILES | CC1C(=O)O[C@H]2C[C@]3(C)O[C@H]3[C@H](OC(=O)Nc3cccs3)[C@@H](N(C)C)C3=C[C@@H](OC3=O)[C@H]12 |
| InChI | InChI=1S/C22H26N2O7S/c1-10-15-12-8-11(20(26)28-12)16(24(3)4)17(30-21(27)23-14-6-5-7-32-14)18-22(2,31-18)9-13(15)29-19(10)25/h5-8,10,12-13,15-18H,9H2,1-4H3,(H,23,27)/t10?,12-,13+,15+,16+,17-,18+,22+/m1/s1 |
| InChIKey | LOUHEVNLPDXYAG-QZYXOFFQSA-N |
| XLogP | 2.19 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|