C9H10Br4O2 — CID 10162260
3,5-dibromo-4-butyl-5-(dibromomethyl)furan-2-one (PubChem CID 10162260) has the molecular formula C9H10Br4O2 and a molecular weight of 469.79 g/mol. Its IUPAC name is 3,5-dibromo-4-butyl-5-(dibromomethyl)furan-2-one.
| Compound Name | 3,5-dibromo-4-butyl-5-(dibromomethyl)furan-2-one |
|---|---|
| PubChem CID | 10162260 |
| Molecular Formula | C9H10Br4O2 |
| Molecular Weight | 469.79 g/mol |
| Exact Mass | 465.74 |
| IUPAC Name | 3,5-dibromo-4-butyl-5-(dibromomethyl)furan-2-one |
| SMILES | CCCCC1=C(Br)C(=O)OC1(Br)C(Br)Br |
| InChI | InChI=1S/C9H10Br4O2/c1-2-3-4-5-6(10)7(14)15-9(5,13)8(11)12/h8H,2-4H2,1H3 |
| InChIKey | PMHNHQGTSKDYHL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.79 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|