C24H18FN5O5 — CID 10162536
N-(4-fluorophenyl)-4-(4-nitronaphthalen-1-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide (PubChem CID 10162536) has the molecular formula C24H18FN5O5 and a molecular weight of 475.44 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-(4-nitronaphthalen-1-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide.
| Compound Name | N-(4-fluorophenyl)-4-(4-nitronaphthalen-1-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
|---|---|
| PubChem CID | 10162536 |
| Molecular Formula | C24H18FN5O5 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-(4-fluorophenyl)-4-(4-nitronaphthalen-1-yl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
| SMILES | O=C1C2C3CC(CN3C(=O)Nc3ccc(F)cc3)N2C(=O)N1c1ccc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C24H18FN5O5/c25-13-5-7-14(8-6-13)26-23(32)27-12-15-11-20(27)21-22(31)29(24(33)28(15)21)18-9-10-19(30(34)35)17-4-2-1-3-16(17)18/h1-10,15,20-21H,11-12H2,(H,26,32) |
| InChIKey | CQFKOCBRYJIBRJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|