C26H30N4O5 — CID 10162707
N-[3-(azepan-1-yl)propyl]-N-(1,3-benzodioxol-5-ylmethyl)-3-(3-nitrophenyl)-1,2-oxazol-5-amine (PubChem CID 10162707) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-N-(1,3-benzodioxol-5-ylmethyl)-3-(3-nitrophenyl)-1,2-oxazol-5-amine.
| Compound Name | N-[3-(azepan-1-yl)propyl]-N-(1,3-benzodioxol-5-ylmethyl)-3-(3-nitrophenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 10162707 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-N-(1,3-benzodioxol-5-ylmethyl)-3-(3-nitrophenyl)-1,2-oxazol-5-amine |
| SMILES | O=[N+]([O-])c1cccc(-c2cc(N(CCCN3CCCCCC3)Cc3ccc4c(c3)OCO4)on2)c1 |
| InChI | InChI=1S/C26H30N4O5/c31-30(32)22-8-5-7-21(16-22)23-17-26(35-27-23)29(14-6-13-28-11-3-1-2-4-12-28)18-20-9-10-24-25(15-20)34-19-33-24/h5,7-10,15-17H,1-4,6,11-14,18-19H2 |
| InChIKey | SUTYVKBDMFTKBS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 94.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|