C28H37FN4O2 — CID 10162871
(2S)-2-N-butyl-1-N-[8-[(6-fluoronaphthalen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]pyrrolidine-1,2-dicarboxamide (PubChem CID 10162871) has the molecular formula C28H37FN4O2 and a molecular weight of 480.63 g/mol. Its IUPAC name is (2S)-2-N-butyl-1-N-[8-[(6-fluoronaphthalen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-2-N-butyl-1-N-[8-[(6-fluoronaphthalen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 10162871 |
| Molecular Formula | C28H37FN4O2 |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (2S)-2-N-butyl-1-N-[8-[(6-fluoronaphthalen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]pyrrolidine-1,2-dicarboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CCCN1C(=O)NC1CC2CCC(C1)N2Cc1ccc2cc(F)ccc2c1 |
| InChI | InChI=1S/C28H37FN4O2/c1-2-3-12-30-27(34)26-5-4-13-32(26)28(35)31-23-16-24-10-11-25(17-23)33(24)18-19-6-7-21-15-22(29)9-8-20(21)14-19/h6-9,14-15,23-26H,2-5,10-13,16-18H2,1H3,(H,30,34)(H,31,35)/t23?,24?,25?,26-/m0/s1 |
| InChIKey | KLHVWBJRVRFJSG-ILVMPNSOSA-N |
| XLogP | 4.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|