C25H30N4O4S — CID 10162991
5-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]pentanoic acid (PubChem CID 10162991) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is 5-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]pentanoic acid.
| Compound Name | 5-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 10162991 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 5-[5-[cyclohexyl(methyl)carbamoyl]-2-(thiophene-2-carbonylamino)benzimidazol-1-yl]pentanoic acid |
| SMILES | CN(C(=O)c1ccc2c(c1)nc(NC(=O)c1cccs1)n2CCCCC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C25H30N4O4S/c1-28(18-8-3-2-4-9-18)24(33)17-12-13-20-19(16-17)26-25(27-23(32)21-10-7-15-34-21)29(20)14-6-5-11-22(30)31/h7,10,12-13,15-16,18H,2-6,8-9,11,14H2,1H3,(H,30,31)(H,26,27,32) |
| InChIKey | LZUOGWACPCWQSP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|