C19H19ClN4O5S2 — CID 10163017
3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-N-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4,6-dimethylphenyl]thiophene-2-carboxamide (PubChem CID 10163017) has the molecular formula C19H19ClN4O5S2 and a molecular weight of 482.97 g/mol. Its IUPAC name is 3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-N-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4,6-dimethylphenyl]thiophene-2-carboxamide.
| Compound Name | 3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-N-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4,6-dimethylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10163017 |
| Molecular Formula | C19H19ClN4O5S2 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 3-[(4-chloro-3-methyl-1,2-oxazol-5-yl)sulfamoyl]-N-[2-[(E)-N-hydroxy-C-methylcarbonimidoyl]-4,6-dimethylphenyl]thiophene-2-carboxamide |
| SMILES | C/C(=N\O)c1cc(C)cc(C)c1NC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl |
| InChI | InChI=1S/C19H19ClN4O5S2/c1-9-7-10(2)16(13(8-9)11(3)22-26)21-18(25)17-14(5-6-30-17)31(27,28)24-19-15(20)12(4)23-29-19/h5-8,24,26H,1-4H3,(H,21,25)/b22-11+ |
| InChIKey | LPTIMJISNYKXKZ-SSDVNMTOSA-N |
| XLogP | 4.57 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|