C27H25N5O4 — CID 10163036
(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-(3-imidazol-1-ylpropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 10163036) has the molecular formula C27H25N5O4 and a molecular weight of 483.53 g/mol. Its IUPAC name is (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-(3-imidazol-1-ylpropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-(3-imidazol-1-ylpropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 10163036 |
| Molecular Formula | C27H25N5O4 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-(3-imidazol-1-ylpropyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1[C@H]2Cc3c([nH]c4ccccc34)[C@@H](c3ccc4c(c3)OCO4)N2C(=O)CN1CCCn1ccnc1 |
| InChI | InChI=1S/C27H25N5O4/c33-24-14-31(10-3-9-30-11-8-28-15-30)27(34)21-13-19-18-4-1-2-5-20(18)29-25(19)26(32(21)24)17-6-7-22-23(12-17)36-16-35-22/h1-2,4-8,11-12,15,21,26,29H,3,9-10,13-14,16H2/t21-,26-/m1/s1 |
| InChIKey | NVLQSQLYABZYKT-QFQXNSOFSA-N |
| XLogP | 2.87 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|