C30H30FNO4 — CID 10163279
5-[2-(cyclopropylmethoxy)ethyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]indole-2-carboxylic acid (PubChem CID 10163279) has the molecular formula C30H30FNO4 and a molecular weight of 487.57 g/mol. Its IUPAC name is 5-[2-(cyclopropylmethoxy)ethyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]indole-2-carboxylic acid.
| Compound Name | 5-[2-(cyclopropylmethoxy)ethyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 10163279 |
| Molecular Formula | C30H30FNO4 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 5-[2-(cyclopropylmethoxy)ethyl]-3-(4-ethoxyphenyl)-1-[(4-fluorophenyl)methyl]indole-2-carboxylic acid |
| SMILES | CCOc1ccc(-c2c(C(=O)O)n(Cc3ccc(F)cc3)c3ccc(CCOCC4CC4)cc23)cc1 |
| InChI | InChI=1S/C30H30FNO4/c1-2-36-25-12-8-23(9-13-25)28-26-17-20(15-16-35-19-22-3-4-22)7-14-27(26)32(29(28)30(33)34)18-21-5-10-24(31)11-6-21/h5-14,17,22H,2-4,15-16,18-19H2,1H3,(H,33,34) |
| InChIKey | KVYPNBVHOVRJNS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|